C19H15NO5 — CID 7095122
(2S)-2-[[3-(2-oxochromen-3-yl)benzoyl]amino]propanoic acid (PubChem CID 7095122) has the molecular formula C19H15NO5 and a molecular weight of 337.33 g/mol. Its IUPAC name is (2S)-2-[[3-(2-oxochromen-3-yl)benzoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[3-(2-oxochromen-3-yl)benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 7095122 |
| Molecular Formula | C19H15NO5 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | (2S)-2-[[3-(2-oxochromen-3-yl)benzoyl]amino]propanoic acid |
| SMILES | C[C@H](NC(=O)c1cccc(-c2cc3ccccc3oc2=O)c1)C(=O)O |
| InChI | InChI=1S/C19H15NO5/c1-11(18(22)23)20-17(21)14-7-4-6-12(9-14)15-10-13-5-2-3-8-16(13)25-19(15)24/h2-11H,1H3,(H,20,21)(H,22,23)/t11-/m0/s1 |
| InChIKey | KUSAKFMNZBMDEJ-NSHDSACASA-N |
| XLogP | 2.66 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|