C22H21NO5S — CID 110210068
methyl 4-methylsulfanyl-2-[[3-(2-oxochromen-3-yl)benzoyl]amino]butanoate (PubChem CID 110210068) has the molecular formula C22H21NO5S and a molecular weight of 411.48 g/mol. Its IUPAC name is methyl 4-methylsulfanyl-2-[[3-(2-oxochromen-3-yl)benzoyl]amino]butanoate.
| Compound Name | methyl 4-methylsulfanyl-2-[[3-(2-oxochromen-3-yl)benzoyl]amino]butanoate |
|---|---|
| PubChem CID | 110210068 |
| Molecular Formula | C22H21NO5S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | methyl 4-methylsulfanyl-2-[[3-(2-oxochromen-3-yl)benzoyl]amino]butanoate |
| SMILES | COC(=O)C(CCSC)NC(=O)c1cccc(-c2cc3ccccc3oc2=O)c1 |
| InChI | InChI=1S/C22H21NO5S/c1-27-22(26)18(10-11-29-2)23-20(24)16-8-5-7-14(12-16)17-13-15-6-3-4-9-19(15)28-21(17)25/h3-9,12-13,18H,10-11H2,1-2H3,(H,23,24) |
| InChIKey | HMDRSXLEKGWHHC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|