C30H36N2O5 — CID 122169930
N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-(2-methoxyethyl)-2-(2-oxo-4-phenylchromen-7-yl)oxyacetamide (PubChem CID 122169930) has the molecular formula C30H36N2O5 and a molecular weight of 504.63 g/mol. Its IUPAC name is N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-(2-methoxyethyl)-2-(2-oxo-4-phenylchromen-7-yl)oxyacetamide.
| Compound Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-(2-methoxyethyl)-2-(2-oxo-4-phenylchromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 122169930 |
| Molecular Formula | C30H36N2O5 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-(2-methoxyethyl)-2-(2-oxo-4-phenylchromen-7-yl)oxyacetamide |
| SMILES | COCCN(C[C@@H]1CCCN2CCCC[C@H]12)C(=O)COc1ccc2c(-c3ccccc3)cc(=O)oc2c1 |
| InChI | InChI=1S/C30H36N2O5/c1-35-17-16-32(20-23-10-7-15-31-14-6-5-11-27(23)31)29(33)21-36-24-12-13-25-26(22-8-3-2-4-9-22)19-30(34)37-28(25)18-24/h2-4,8-9,12-13,18-19,23,27H,5-7,10-11,14-17,20-21H2,1H3/t23-,27+/m0/s1 |
| InChIKey | HZLXZYHYTUDHHU-WNCULLNHSA-N |
| XLogP | 4.58 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|