C32H40N2O5 — CID 125462640
N-[[(1R,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-(2-methoxyethyl)-3-(7-methoxy-2-oxo-4-phenylchromen-6-yl)propanamide (PubChem CID 125462640) has the molecular formula C32H40N2O5 and a molecular weight of 532.68 g/mol. Its IUPAC name is N-[[(1R,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-(2-methoxyethyl)-3-(7-methoxy-2-oxo-4-phenylchromen-6-yl)propanamide.
| Compound Name | N-[[(1R,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-(2-methoxyethyl)-3-(7-methoxy-2-oxo-4-phenylchromen-6-yl)propanamide |
|---|---|
| PubChem CID | 125462640 |
| Molecular Formula | C32H40N2O5 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.29 |
| IUPAC Name | N-[[(1R,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-(2-methoxyethyl)-3-(7-methoxy-2-oxo-4-phenylchromen-6-yl)propanamide |
| SMILES | COCCN(C[C@H]1CCCN2CCCC[C@@H]12)C(=O)CCc1cc2c(-c3ccccc3)cc(=O)oc2cc1OC |
| InChI | InChI=1S/C32H40N2O5/c1-37-18-17-34(22-25-11-8-16-33-15-7-6-12-28(25)33)31(35)14-13-24-19-27-26(23-9-4-3-5-10-23)20-32(36)39-30(27)21-29(24)38-2/h3-5,9-10,19-21,25,28H,6-8,11-18,22H2,1-2H3/t25-,28+/m1/s1 |
| InChIKey | LLTGVRIILDILAJ-NAKRPHOHSA-N |
| XLogP | 5.14 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|