C25H37N3O2 — CID 122169942
N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-(2-methoxyethyl)-3-(1-methylindol-3-yl)propanamide (PubChem CID 122169942) has the molecular formula C25H37N3O2 and a molecular weight of 411.59 g/mol. Its IUPAC name is N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-(2-methoxyethyl)-3-(1-methylindol-3-yl)propanamide.
| Compound Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-(2-methoxyethyl)-3-(1-methylindol-3-yl)propanamide |
|---|---|
| PubChem CID | 122169942 |
| Molecular Formula | C25H37N3O2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.29 |
| IUPAC Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-(2-methoxyethyl)-3-(1-methylindol-3-yl)propanamide |
| SMILES | COCCN(C[C@@H]1CCCN2CCCC[C@H]12)C(=O)CCc1cn(C)c2ccccc12 |
| InChI | InChI=1S/C25H37N3O2/c1-26-18-20(22-9-3-4-11-24(22)26)12-13-25(29)28(16-17-30-2)19-21-8-7-15-27-14-6-5-10-23(21)27/h3-4,9,11,18,21,23H,5-8,10,12-17,19H2,1-2H3/t21-,23+/m0/s1 |
| InChIKey | OTSPUXOMYFUVKN-JTHBVZDNSA-N |
| XLogP | 3.85 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |