C23H33N3O — CID 110208151
N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-methyl-3-(1-methylindol-3-yl)propanamide (PubChem CID 110208151) has the molecular formula C23H33N3O and a molecular weight of 367.54 g/mol. Its IUPAC name is N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-methyl-3-(1-methylindol-3-yl)propanamide.
| Compound Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-methyl-3-(1-methylindol-3-yl)propanamide |
|---|---|
| PubChem CID | 110208151 |
| Molecular Formula | C23H33N3O |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.26 |
| IUPAC Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-methyl-3-(1-methylindol-3-yl)propanamide |
| SMILES | CN(C[C@@H]1CCCN2CCCC[C@H]12)C(=O)CCc1cn(C)c2ccccc12 |
| InChI | InChI=1S/C23H33N3O/c1-24-16-18(20-9-3-4-11-22(20)24)12-13-23(27)25(2)17-19-8-7-15-26-14-6-5-10-21(19)26/h3-4,9,11,16,19,21H,5-8,10,12-15,17H2,1-2H3/t19-,21+/m0/s1 |
| InChIKey | XMAZFILPXNXLMX-PZJWPPBQSA-N |
| XLogP | 3.83 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |