C17H22N2O3S — CID 110852886
N-(1,1-dioxothiolan-3-yl)-N-methyl-3-(1-methylindol-3-yl)propanamide (PubChem CID 110852886) has the molecular formula C17H22N2O3S and a molecular weight of 334.44 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-methyl-3-(1-methylindol-3-yl)propanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-methyl-3-(1-methylindol-3-yl)propanamide |
|---|---|
| PubChem CID | 110852886 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-methyl-3-(1-methylindol-3-yl)propanamide |
| SMILES | CN(C(=O)CCc1cn(C)c2ccccc12)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H22N2O3S/c1-18-11-13(15-5-3-4-6-16(15)18)7-8-17(20)19(2)14-9-10-23(21,22)12-14/h3-6,11,14H,7-10,12H2,1-2H3 |
| InChIKey | NIWRFNAQCLNBHR-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |