C16H20N2O3S — CID 71702598
N-(1,1-dioxothiolan-3-yl)-3-(1-methylindol-3-yl)propanamide (PubChem CID 71702598) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-(1-methylindol-3-yl)propanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-(1-methylindol-3-yl)propanamide |
|---|---|
| PubChem CID | 71702598 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-(1-methylindol-3-yl)propanamide |
| SMILES | Cn1cc(CCC(=O)NC2CCS(=O)(=O)C2)c2ccccc21 |
| InChI | InChI=1S/C16H20N2O3S/c1-18-10-12(14-4-2-3-5-15(14)18)6-7-16(19)17-13-8-9-22(20,21)11-13/h2-5,10,13H,6-9,11H2,1H3,(H,17,19) |
| InChIKey | ZMFJUFKCKGJWDE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |