C19H26N2O4S — CID 71704377
N-(1,1-dioxothiolan-3-yl)-4-[1-(2-methoxyethyl)indol-3-yl]butanamide (PubChem CID 71704377) has the molecular formula C19H26N2O4S and a molecular weight of 378.49 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-4-[1-(2-methoxyethyl)indol-3-yl]butanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-4-[1-(2-methoxyethyl)indol-3-yl]butanamide |
|---|---|
| PubChem CID | 71704377 |
| Molecular Formula | C19H26N2O4S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-4-[1-(2-methoxyethyl)indol-3-yl]butanamide |
| SMILES | COCCn1cc(CCCC(=O)NC2CCS(=O)(=O)C2)c2ccccc21 |
| InChI | InChI=1S/C19H26N2O4S/c1-25-11-10-21-13-15(17-6-2-3-7-18(17)21)5-4-8-19(22)20-16-9-12-26(23,24)14-16/h2-3,6-7,13,16H,4-5,8-12,14H2,1H3,(H,20,22) |
| InChIKey | PRLCGQXIOFWPRR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |