C12H18N2O3S — CID 128963547
N-(1,1-dioxothiolan-3-yl)-4-pyrrol-1-ylbutanamide (PubChem CID 128963547) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-4-pyrrol-1-ylbutanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-4-pyrrol-1-ylbutanamide |
|---|---|
| PubChem CID | 128963547 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-4-pyrrol-1-ylbutanamide |
| SMILES | O=C(CCCn1cccc1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H18N2O3S/c15-12(4-3-8-14-6-1-2-7-14)13-11-5-9-18(16,17)10-11/h1-2,6-7,11H,3-5,8-10H2,(H,13,15) |
| InChIKey | ZHLMACZYDZXRSO-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |