C20H34N4O2 — CID 125428031
N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-(2-methoxyethyl)-1-propan-2-ylpyrazole-4-carboxamide (PubChem CID 125428031) has the molecular formula C20H34N4O2 and a molecular weight of 362.52 g/mol. Its IUPAC name is N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-(2-methoxyethyl)-1-propan-2-ylpyrazole-4-carboxamide.
| Compound Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-(2-methoxyethyl)-1-propan-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 125428031 |
| Molecular Formula | C20H34N4O2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-(2-methoxyethyl)-1-propan-2-ylpyrazole-4-carboxamide |
| SMILES | COCCN(C[C@@H]1CCCN2CCCC[C@H]12)C(=O)c1cnn(C(C)C)c1 |
| InChI | InChI=1S/C20H34N4O2/c1-16(2)24-15-18(13-21-24)20(25)23(11-12-26-3)14-17-7-6-10-22-9-5-4-8-19(17)22/h13,15-17,19H,4-12,14H2,1-3H3/t17-,19+/m0/s1 |
| InChIKey | STJRCWDUEGRVAX-PKOBYXMFSA-N |
| XLogP | 2.82 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |