C24H39N3O4 — CID 125430373
1-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-1-(2-methoxyethyl)urea (PubChem CID 125430373) has the molecular formula C24H39N3O4 and a molecular weight of 433.59 g/mol. Its IUPAC name is 1-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-1-(2-methoxyethyl)urea.
| Compound Name | 1-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-1-(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 125430373 |
| Molecular Formula | C24H39N3O4 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.29 |
| IUPAC Name | 1-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-1-(2-methoxyethyl)urea |
| SMILES | COCCN(C[C@@H]1CCCN2CCCC[C@H]12)C(=O)NCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C24H39N3O4/c1-29-16-15-27(18-20-7-6-14-26-13-5-4-8-21(20)26)24(28)25-12-11-19-9-10-22(30-2)23(17-19)31-3/h9-10,17,20-21H,4-8,11-16,18H2,1-3H3,(H,25,28)/t20-,21+/m0/s1 |
| InChIKey | JVQROFJDSFUUGN-LEWJYISDSA-N |
| XLogP | 3.17 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |