C30H36N2O4 — CID 122169743
N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-(3-methoxypropyl)-3-(2-oxochromen-3-yl)benzamide (PubChem CID 122169743) has the molecular formula C30H36N2O4 and a molecular weight of 488.63 g/mol. Its IUPAC name is N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-(3-methoxypropyl)-3-(2-oxochromen-3-yl)benzamide.
| Compound Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-(3-methoxypropyl)-3-(2-oxochromen-3-yl)benzamide |
|---|---|
| PubChem CID | 122169743 |
| Molecular Formula | C30H36N2O4 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-(3-methoxypropyl)-3-(2-oxochromen-3-yl)benzamide |
| SMILES | COCCCN(C[C@@H]1CCCN2CCCC[C@H]12)C(=O)c1cccc(-c2cc3ccccc3oc2=O)c1 |
| InChI | InChI=1S/C30H36N2O4/c1-35-18-8-17-32(21-25-12-7-16-31-15-5-4-13-27(25)31)29(33)24-11-6-10-22(19-24)26-20-23-9-2-3-14-28(23)36-30(26)34/h2-3,6,9-11,14,19-20,25,27H,4-5,7-8,12-13,15-18,21H2,1H3/t25-,27+/m0/s1 |
| InChIKey | IUDVXYQJJQZBOH-AHKZPQOWSA-N |
| XLogP | 5.20 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|