C22H40N2O2S2 — CID 163070272
N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-5-(dithiolan-3-yl)-N-(3-methoxypropyl)pentanamide (PubChem CID 163070272) has the molecular formula C22H40N2O2S2 and a molecular weight of 428.71 g/mol. Its IUPAC name is N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-5-(dithiolan-3-yl)-N-(3-methoxypropyl)pentanamide.
| Compound Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-5-(dithiolan-3-yl)-N-(3-methoxypropyl)pentanamide |
|---|---|
| PubChem CID | 163070272 |
| Molecular Formula | C22H40N2O2S2 |
| Molecular Weight | 428.71 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-5-(dithiolan-3-yl)-N-(3-methoxypropyl)pentanamide |
| SMILES | COCCCN(CC1CCCN2CCCCC12)C(=O)CCCCC1CCSS1 |
| InChI | InChI=1S/C22H40N2O2S2/c1-26-16-7-15-24(22(25)11-3-2-9-20-12-17-27-28-20)18-19-8-6-14-23-13-5-4-10-21(19)23/h19-21H,2-18H2,1H3 |
| InChIKey | YNUNLQRCFFUJHD-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.71 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|