C24H42N4O3S — CID 122169751
N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(3-methoxypropyl)pentanamide (PubChem CID 122169751) has the molecular formula C24H42N4O3S and a molecular weight of 466.69 g/mol. Its IUPAC name is N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(3-methoxypropyl)pentanamide.
| Compound Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(3-methoxypropyl)pentanamide |
|---|---|
| PubChem CID | 122169751 |
| Molecular Formula | C24H42N4O3S |
| Molecular Weight | 466.69 g/mol |
| Exact Mass | 466.30 |
| IUPAC Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(3-methoxypropyl)pentanamide |
| SMILES | COCCCN(C[C@@H]1CCCN2CCCC[C@H]12)C(=O)CCCCC1SC[C@@H]2NC(=O)N[C@H]12 |
| InChI | InChI=1S/C24H42N4O3S/c1-31-15-7-14-28(16-18-8-6-13-27-12-5-4-9-20(18)27)22(29)11-3-2-10-21-23-19(17-32-21)25-24(30)26-23/h18-21,23H,2-17H2,1H3,(H2,25,26,30)/t18-,19-,20+,21?,23-/m0/s1 |
| InChIKey | SULMLOVGLFJYEB-QBSFRXLHSA-N |
| XLogP | 2.84 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.69 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|