C15H23N3O4S — CID 119371610
(2R)-1-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 119371610) has the molecular formula C15H23N3O4S and a molecular weight of 341.43 g/mol. Its IUPAC name is (2R)-1-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 119371610 |
| Molecular Formula | C15H23N3O4S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (2R)-1-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C1NC2CSC(CCCCC(=O)N3CCC[C@@H]3C(=O)O)C2N1 |
| InChI | InChI=1S/C15H23N3O4S/c19-12(18-7-3-4-10(18)14(20)21)6-2-1-5-11-13-9(8-23-11)16-15(22)17-13/h9-11,13H,1-8H2,(H,20,21)(H2,16,17,22)/t9?,10-,11?,13?/m1/s1 |
| InChIKey | BUMQEZTZKUQOEA-AQICRGNOSA-N |
| XLogP | 0.79 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|