C17H31ClN4O2S — CID 119436423
(3aS,4S,6aR)-4-[5-[2-(1-aminoethyl)piperidin-1-yl]-5-oxopentyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one;hydrochloride (PubChem CID 119436423) has the molecular formula C17H31ClN4O2S and a molecular weight of 390.98 g/mol. Its IUPAC name is (3aS,4S,6aR)-4-[5-[2-(1-aminoethyl)piperidin-1-yl]-5-oxopentyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one;hydrochloride.
| Compound Name | (3aS,4S,6aR)-4-[5-[2-(1-aminoethyl)piperidin-1-yl]-5-oxopentyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one;hydrochloride |
|---|---|
| PubChem CID | 119436423 |
| Molecular Formula | C17H31ClN4O2S |
| Molecular Weight | 390.98 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | (3aS,4S,6aR)-4-[5-[2-(1-aminoethyl)piperidin-1-yl]-5-oxopentyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one;hydrochloride |
| SMILES | CC(N)C1CCCCN1C(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21.Cl |
| InChI | InChI=1S/C17H30N4O2S.ClH/c1-11(18)13-6-4-5-9-21(13)15(22)8-3-2-7-14-16-12(10-24-14)19-17(23)20-16;/h11-14,16H,2-10,18H2,1H3,(H2,19,20,23);1H/t11?,12-,13?,14-,16-;/m0./s1 |
| InChIKey | DJTRXTXFQAEAJK-GHWGVGKBSA-N |
| XLogP | 1.86 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.98 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|