C23H31N5O2S — CID 110205990
(3aS,4S,6aR)-4-[5-[2-(1-methylbenzimidazol-2-yl)piperidin-1-yl]-5-oxopentyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one (PubChem CID 110205990) has the molecular formula C23H31N5O2S and a molecular weight of 441.60 g/mol. Its IUPAC name is (3aS,4S,6aR)-4-[5-[2-(1-methylbenzimidazol-2-yl)piperidin-1-yl]-5-oxopentyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one.
| Compound Name | (3aS,4S,6aR)-4-[5-[2-(1-methylbenzimidazol-2-yl)piperidin-1-yl]-5-oxopentyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
|---|---|
| PubChem CID | 110205990 |
| Molecular Formula | C23H31N5O2S |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | (3aS,4S,6aR)-4-[5-[2-(1-methylbenzimidazol-2-yl)piperidin-1-yl]-5-oxopentyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
| SMILES | Cn1c(C2CCCCN2C(=O)CCCC[C@@H]2SC[C@@H]3NC(=O)N[C@@H]32)nc2ccccc21 |
| InChI | InChI=1S/C23H31N5O2S/c1-27-17-9-3-2-8-15(17)24-22(27)18-10-6-7-13-28(18)20(29)12-5-4-11-19-21-16(14-31-19)25-23(30)26-21/h2-3,8-9,16,18-19,21H,4-7,10-14H2,1H3,(H2,25,26,30)/t16-,18?,19-,21-/m0/s1 |
| InChIKey | OMJSLOZZELXNAK-VNVVPAOKSA-N |
| XLogP | 3.35 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|