C23H24N3O2S+ — CID 22852053
(3aS,4S,6aR)-4-(5-acridin-10-ium-10-yl-5-oxopentyl)-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one (PubChem CID 22852053) has the molecular formula C23H24N3O2S+ and a molecular weight of 406.53 g/mol. Its IUPAC name is (3aS,4S,6aR)-4-(5-acridin-10-ium-10-yl-5-oxopentyl)-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one.
| Compound Name | (3aS,4S,6aR)-4-(5-acridin-10-ium-10-yl-5-oxopentyl)-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
|---|---|
| PubChem CID | 22852053 |
| Molecular Formula | C23H24N3O2S+ |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | (3aS,4S,6aR)-4-(5-acridin-10-ium-10-yl-5-oxopentyl)-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
| SMILES | O=C1N[C@H]2[C@H](CS[C@H]2CCCCC(=O)[n+]2c3ccccc3cc3ccccc32)N1 |
| InChI | InChI=1S/C23H23N3O2S/c27-21(12-6-5-11-20-22-17(14-29-20)24-23(28)25-22)26-18-9-3-1-7-15(18)13-16-8-2-4-10-19(16)26/h1-4,7-10,13,17,20,22H,5-6,11-12,14H2,(H-,24,25,28)/p+1/t17-,20-,22-/m0/s1 |
| InChIKey | WGXYGAWRZRZDEP-XJABCFGWSA-O |
| XLogP | 3.65 |
| TPSA | 62.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|