C20H24N4O3S3 — CID 87930696
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid;2-(pyridin-2-yldisulfanyl)pyridine (PubChem CID 87930696) has the molecular formula C20H24N4O3S3 and a molecular weight of 464.64 g/mol. Its IUPAC name is 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid;2-(pyridin-2-yldisulfanyl)pyridine.
| Compound Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid;2-(pyridin-2-yldisulfanyl)pyridine |
|---|---|
| PubChem CID | 87930696 |
| Molecular Formula | C20H24N4O3S3 |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid;2-(pyridin-2-yldisulfanyl)pyridine |
| SMILES | O=C(O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21.c1ccc(SSc2ccccn2)nc1 |
| InChI | InChI=1S/C10H16N2O3S.C10H8N2S2/c13-8(14)4-2-1-3-7-9-6(5-16-7)11-10(15)12-9;1-3-7-11-9(5-1)13-14-10-6-2-4-8-12-10/h6-7,9H,1-5H2,(H,13,14)(H2,11,12,15);1-8H/t6-,7-,9-;/m0./s1 |
| InChIKey | SBQHQXYJLCHYBJ-UFLZEWODSA-N |
| XLogP | 4.07 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|