C21H26N2O5S — CID 161158492
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid;3-(hydroxymethyl)naphthalen-2-ol (PubChem CID 161158492) has the molecular formula C21H26N2O5S and a molecular weight of 418.52 g/mol. Its IUPAC name is 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid;3-(hydroxymethyl)naphthalen-2-ol.
| Compound Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid;3-(hydroxymethyl)naphthalen-2-ol |
|---|---|
| PubChem CID | 161158492 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid;3-(hydroxymethyl)naphthalen-2-ol |
| SMILES | O=C(O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21.OCc1cc2ccccc2cc1O |
| InChI | InChI=1S/C11H10O2.C10H16N2O3S/c12-7-10-5-8-3-1-2-4-9(8)6-11(10)13;13-8(14)4-2-1-3-7-9-6(5-16-7)11-10(15)12-9/h1-6,12-13H,7H2;6-7,9H,1-5H2,(H,13,14)(H2,11,12,15)/t;6-,7-,9-/m.0/s1 |
| InChIKey | UPPOKCOKKODVGE-CAGKOAJJSA-N |
| XLogP | 2.83 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|