C22H29N3O5S — CID 158117067
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid;4-(1H-indol-3-yl)butanoic acid (PubChem CID 158117067) has the molecular formula C22H29N3O5S and a molecular weight of 447.56 g/mol. Its IUPAC name is 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid;4-(1H-indol-3-yl)butanoic acid.
| Compound Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid;4-(1H-indol-3-yl)butanoic acid |
|---|---|
| PubChem CID | 158117067 |
| Molecular Formula | C22H29N3O5S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid;4-(1H-indol-3-yl)butanoic acid |
| SMILES | O=C(O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21.O=C(O)CCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C12H13NO2.C10H16N2O3S/c14-12(15)7-3-4-9-8-13-11-6-2-1-5-10(9)11;13-8(14)4-2-1-3-7-9-6(5-16-7)11-10(15)12-9/h1-2,5-6,8,13H,3-4,7H2,(H,14,15);6-7,9H,1-5H2,(H,13,14)(H2,11,12,15)/t;6-,7-,9-/m.0/s1 |
| InChIKey | FRDIOBWSDFXKQU-CAGKOAJJSA-N |
| XLogP | 3.37 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|