C18H21N3O6S — CID 160877041
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid;1H-3,1-benzoxazine-2,4-dione (PubChem CID 160877041) has the molecular formula C18H21N3O6S and a molecular weight of 407.45 g/mol. Its IUPAC name is 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid;1H-3,1-benzoxazine-2,4-dione.
| Compound Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid;1H-3,1-benzoxazine-2,4-dione |
|---|---|
| PubChem CID | 160877041 |
| Molecular Formula | C18H21N3O6S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid;1H-3,1-benzoxazine-2,4-dione |
| SMILES | O=C(O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21.O=c1[nH]c2ccccc2c(=O)o1 |
| InChI | InChI=1S/C10H16N2O3S.C8H5NO3/c13-8(14)4-2-1-3-7-9-6(5-16-7)11-10(15)12-9;10-7-5-3-1-2-4-6(5)9-8(11)12-7/h6-7,9H,1-5H2,(H,13,14)(H2,11,12,15);1-4H,(H,9,11)/t6-,7-,9-;/m0./s1 |
| InChIKey | SMNMFRWIQCWBNC-UFLZEWODSA-N |
| XLogP | 1.28 |
| TPSA | 141.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|