C50H53N3O2P2S+2 — CID 88902611
2-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoyl-(2-triphenylphosphaniumylethyl)amino]ethyl-triphenylphosphanium (PubChem CID 88902611) has the molecular formula C50H53N3O2P2S+2 and a molecular weight of 822.01 g/mol. Its IUPAC name is 2-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoyl-(2-triphenylphosphaniumylethyl)amino]ethyl-triphenylphosphanium.
| Compound Name | 2-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoyl-(2-triphenylphosphaniumylethyl)amino]ethyl-triphenylphosphanium |
|---|---|
| PubChem CID | 88902611 |
| Molecular Formula | C50H53N3O2P2S+2 |
| Molecular Weight | 822.01 g/mol |
| Exact Mass | 821.33 |
| IUPAC Name | 2-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoyl-(2-triphenylphosphaniumylethyl)amino]ethyl-triphenylphosphanium |
| SMILES | O=C1NC2CSC(CCCCC(=O)N(CC[P+](c3ccccc3)(c3ccccc3)c3ccccc3)CC[P+](c3ccccc3)(c3ccccc3)c3ccccc3)C2N1 |
| InChI | InChI=1S/C50H52N3O2P2S/c54-48(34-20-19-33-47-49-46(39-58-47)51-50(55)52-49)53(35-37-56(40-21-7-1-8-22-40,41-23-9-2-10-24-41)42-25-11-3-12-26-42)36-38-57(43-27-13-4-14-28-43,44-29-15-5-16-30-44)45-31-17-6-18-32-45/h1-18,21-32,46-47,49H,19-20,33-39H2,(H-,51,52,55)/q+1/p+1 |
| InChIKey | YANJAWZHLZYBTR-UHFFFAOYSA-O |
| XLogP | 7.53 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.01 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|