C17H32N4O2S — CID 119659733
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(3-amino-4-methylpentyl)-N-methylpentanamide (PubChem CID 119659733) has the molecular formula C17H32N4O2S and a molecular weight of 356.54 g/mol. Its IUPAC name is 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(3-amino-4-methylpentyl)-N-methylpentanamide.
| Compound Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(3-amino-4-methylpentyl)-N-methylpentanamide |
|---|---|
| PubChem CID | 119659733 |
| Molecular Formula | C17H32N4O2S |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(3-amino-4-methylpentyl)-N-methylpentanamide |
| SMILES | CC(C)C(N)CCN(C)C(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21 |
| InChI | InChI=1S/C17H32N4O2S/c1-11(2)12(18)8-9-21(3)15(22)7-5-4-6-14-16-13(10-24-14)19-17(23)20-16/h11-14,16H,4-10,18H2,1-3H3,(H2,19,20,23)/t12?,13-,14-,16-/m0/s1 |
| InChIKey | JOXKOVPIVZJQOW-YIGWGJNQSA-N |
| XLogP | 1.54 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|