C21H37N3O2S — CID 59125335
(3aR,6aS)-4-[5-[4,4-di(propan-2-yl)piperidin-1-yl]-5-oxopentyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one (PubChem CID 59125335) has the molecular formula C21H37N3O2S and a molecular weight of 395.61 g/mol. Its IUPAC name is (3aR,6aS)-4-[5-[4,4-di(propan-2-yl)piperidin-1-yl]-5-oxopentyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one.
| Compound Name | (3aR,6aS)-4-[5-[4,4-di(propan-2-yl)piperidin-1-yl]-5-oxopentyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
|---|---|
| PubChem CID | 59125335 |
| Molecular Formula | C21H37N3O2S |
| Molecular Weight | 395.61 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | (3aR,6aS)-4-[5-[4,4-di(propan-2-yl)piperidin-1-yl]-5-oxopentyl]-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one |
| SMILES | CC(C)C1(C(C)C)CCN(C(=O)CCCCC2SC[C@H]3NC(=O)N[C@@H]23)CC1 |
| InChI | InChI=1S/C21H37N3O2S/c1-14(2)21(15(3)4)9-11-24(12-10-21)18(25)8-6-5-7-17-19-16(13-27-17)22-20(26)23-19/h14-17,19H,5-13H2,1-4H3,(H2,22,23,26)/t16-,17?,19-/m1/s1 |
| InChIKey | HQJVXUZJWRMHDZ-IRQCGSAXSA-N |
| XLogP | 3.63 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.61 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|