C26H38N4O5 — CID 110208046
N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-3-[(4S)-1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-methylpropanamide (PubChem CID 110208046) has the molecular formula C26H38N4O5 and a molecular weight of 486.61 g/mol. Its IUPAC name is N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-3-[(4S)-1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-methylpropanamide.
| Compound Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-3-[(4S)-1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 110208046 |
| Molecular Formula | C26H38N4O5 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-3-[(4S)-1-[(3,4-dimethoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-methylpropanamide |
| SMILES | COc1ccc(CN2C(=O)N[C@@H](CCC(=O)N(C)C[C@@H]3CCCN4CCCC[C@H]34)C2=O)cc1OC |
| InChI | InChI=1S/C26H38N4O5/c1-28(17-19-7-6-14-29-13-5-4-8-21(19)29)24(31)12-10-20-25(32)30(26(33)27-20)16-18-9-11-22(34-2)23(15-18)35-3/h9,11,15,19-21H,4-8,10,12-14,16-17H2,1-3H3,(H,27,33)/t19-,20-,21+/m0/s1 |
| InChIKey | FKESLNCFQIAMJE-PCCBWWKXSA-N |
| XLogP | 2.63 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|