C23H31ClN4O3 — CID 110209687
N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-3-[1-[(3-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]propanamide (PubChem CID 110209687) has the molecular formula C23H31ClN4O3 and a molecular weight of 446.98 g/mol. Its IUPAC name is N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-3-[1-[(3-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]propanamide.
| Compound Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-3-[1-[(3-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]propanamide |
|---|---|
| PubChem CID | 110209687 |
| Molecular Formula | C23H31ClN4O3 |
| Molecular Weight | 446.98 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-3-[1-[(3-chlorophenyl)methyl]-2,5-dioxoimidazolidin-4-yl]propanamide |
| SMILES | O=C(CCC1NC(=O)N(Cc2cccc(Cl)c2)C1=O)NCC1CCCN2CCCCC12 |
| InChI | InChI=1S/C23H31ClN4O3/c24-18-7-3-5-16(13-18)15-28-22(30)19(26-23(28)31)9-10-21(29)25-14-17-6-4-12-27-11-2-1-8-20(17)27/h3,5,7,13,17,19-20H,1-2,4,6,8-12,14-15H2,(H,25,29)(H,26,31) |
| InChIKey | MMQQPBNERVFTQM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.98 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|