C21H29N3O3 — CID 91636949
N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-5,6-dimethoxy-1H-indole-2-carboxamide (PubChem CID 91636949) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-5,6-dimethoxy-1H-indole-2-carboxamide.
| Compound Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-5,6-dimethoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 91636949 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-5,6-dimethoxy-1H-indole-2-carboxamide |
| SMILES | COc1cc2cc(C(=O)NC[C@@H]3CCCN4CCCC[C@H]34)[nH]c2cc1OC |
| InChI | InChI=1S/C21H29N3O3/c1-26-19-11-15-10-17(23-16(15)12-20(19)27-2)21(25)22-13-14-6-5-9-24-8-4-3-7-18(14)24/h10-12,14,18,23H,3-9,13H2,1-2H3,(H,22,25)/t14-,18+/m0/s1 |
| InChIKey | PKHMBEFIUOMVOT-KBXCAEBGSA-N |
| XLogP | 3.18 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |