C28H35N3O4 — CID 162892158
N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-4-[3-(3,4-dimethoxyphenyl)prop-2-enoylamino]benzamide (PubChem CID 162892158) has the molecular formula C28H35N3O4 and a molecular weight of 477.61 g/mol. Its IUPAC name is N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-4-[3-(3,4-dimethoxyphenyl)prop-2-enoylamino]benzamide.
| Compound Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-4-[3-(3,4-dimethoxyphenyl)prop-2-enoylamino]benzamide |
|---|---|
| PubChem CID | 162892158 |
| Molecular Formula | C28H35N3O4 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-4-[3-(3,4-dimethoxyphenyl)prop-2-enoylamino]benzamide |
| SMILES | COc1ccc(C=CC(=O)Nc2ccc(C(=O)NCC3CCCN4CCCCC34)cc2)cc1OC |
| InChI | InChI=1S/C28H35N3O4/c1-34-25-14-8-20(18-26(25)35-2)9-15-27(32)30-23-12-10-21(11-13-23)28(33)29-19-22-6-5-17-31-16-4-3-7-24(22)31/h8-15,18,22,24H,3-7,16-17,19H2,1-2H3,(H,29,33)(H,30,32) |
| InChIKey | YDMXEXBMDNXHJE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|