C19H28N2O4S — CID 10523842
N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2-methoxy-5-methylsulfonylbenzamide (PubChem CID 10523842) has the molecular formula C19H28N2O4S and a molecular weight of 380.51 g/mol. Its IUPAC name is N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2-methoxy-5-methylsulfonylbenzamide.
| Compound Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2-methoxy-5-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 10523842 |
| Molecular Formula | C19H28N2O4S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2-methoxy-5-methylsulfonylbenzamide |
| SMILES | COc1ccc(S(C)(=O)=O)cc1C(=O)NC[C@@H]1CCCN2CCCC[C@H]12 |
| InChI | InChI=1S/C19H28N2O4S/c1-25-18-9-8-15(26(2,23)24)12-16(18)19(22)20-13-14-6-5-11-21-10-4-3-7-17(14)21/h8-9,12,14,17H,3-7,10-11,13H2,1-2H3,(H,20,22)/t14-,17+/m0/s1 |
| InChIKey | CGDNTLAWNMPJLO-WMLDXEAASA-N |
| XLogP | 2.09 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |