C21H27ClN4O2 — CID 91638168
N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-5-(3-chloro-4-methoxyphenyl)-1H-pyrazole-4-carboxamide (PubChem CID 91638168) has the molecular formula C21H27ClN4O2 and a molecular weight of 402.93 g/mol. Its IUPAC name is N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-5-(3-chloro-4-methoxyphenyl)-1H-pyrazole-4-carboxamide.
| Compound Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-5-(3-chloro-4-methoxyphenyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 91638168 |
| Molecular Formula | C21H27ClN4O2 |
| Molecular Weight | 402.93 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-5-(3-chloro-4-methoxyphenyl)-1H-pyrazole-4-carboxamide |
| SMILES | COc1ccc(-c2[nH]ncc2C(=O)NCC2CCCN3CCCCC23)cc1Cl |
| InChI | InChI=1S/C21H27ClN4O2/c1-28-19-8-7-14(11-17(19)22)20-16(13-24-25-20)21(27)23-12-15-5-4-10-26-9-3-2-6-18(15)26/h7-8,11,13,15,18H,2-6,9-10,12H2,1H3,(H,23,27)(H,24,25) |
| InChIKey | LNQHBBQGMXBOHP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.93 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |