C19H25N3O3 — CID 71824298
N-(cyclohexylmethyl)-5-(3,4-dimethoxyphenyl)-1H-pyrazole-4-carboxamide (PubChem CID 71824298) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-5-(3,4-dimethoxyphenyl)-1H-pyrazole-4-carboxamide.
| Compound Name | N-(cyclohexylmethyl)-5-(3,4-dimethoxyphenyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 71824298 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-(cyclohexylmethyl)-5-(3,4-dimethoxyphenyl)-1H-pyrazole-4-carboxamide |
| SMILES | COc1ccc(-c2[nH]ncc2C(=O)NCC2CCCCC2)cc1OC |
| InChI | InChI=1S/C19H25N3O3/c1-24-16-9-8-14(10-17(16)25-2)18-15(12-21-22-18)19(23)20-11-13-6-4-3-5-7-13/h8-10,12-13H,3-7,11H2,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | CTAIUEXKAGYTFX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |