C22H30N4O3 — CID 100906393
N-[[(1R,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-5-(3,4-dimethoxyphenyl)-1H-pyrazole-4-carboxamide (PubChem CID 100906393) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is N-[[(1R,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-5-(3,4-dimethoxyphenyl)-1H-pyrazole-4-carboxamide.
| Compound Name | N-[[(1R,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-5-(3,4-dimethoxyphenyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 100906393 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | N-[[(1R,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-5-(3,4-dimethoxyphenyl)-1H-pyrazole-4-carboxamide |
| SMILES | COc1ccc(-c2[nH]ncc2C(=O)NC[C@H]2CCCN3CCCC[C@@H]23)cc1OC |
| InChI | InChI=1S/C22H30N4O3/c1-28-19-9-8-15(12-20(19)29-2)21-17(14-24-25-21)22(27)23-13-16-6-5-11-26-10-4-3-7-18(16)26/h8-9,12,14,16,18H,3-7,10-11,13H2,1-2H3,(H,23,27)(H,24,25)/t16-,18+/m1/s1 |
| InChIKey | YHPWCOWFBXAUTA-AEFFLSMTSA-N |
| XLogP | 3.09 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |