2-[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]acetic acid

C13H14N2O4 — CID 82302588

IUPAC2-[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]acetic acid
SMILESCOc1ccc(-c2[nH]ncc2CC(=O)O)cc1OC
InChIInChI=1S/C13H14N2O4/c1-18-10-4-3-8(5-11(10)19-2)13-9(6-12(16)17)7-14-15-13/h3-5,7H,6H2,1-2H3,(H,14,15)(H,16,17)
InChIKeyHOYLXELFDPXFKV-UHFFFAOYSA-N
MW262.26 g/mol
LogP1.72
Rot. Bonds5

About 2-[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]acetic acid

2-[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]acetic acid (PubChem CID 82302588) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is 2-[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]acetic acid.

Molecular Properties

Compound Name2-[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]acetic acid
PubChem CID82302588
Molecular FormulaC13H14N2O4
Molecular Weight262.26 g/mol
Exact Mass262.10
IUPAC Name2-[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]acetic acid
SMILESCOc1ccc(-c2[nH]ncc2CC(=O)O)cc1OC
InChIInChI=1S/C13H14N2O4/c1-18-10-4-3-8(5-11(10)19-2)13-9(6-12(16)17)7-14-15-13/h3-5,7H,6H2,1-2H3,(H,14,15)(H,16,17)
InChIKeyHOYLXELFDPXFKV-UHFFFAOYSA-N
XLogP1.72
TPSA84.44 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.26
LogP ≤ 51.72
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]acetic acid?
The IUPAC name of 2-[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]acetic acid (CID 82302588) is 2-[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]acetic acid.
What is the SMILES notation for 2-[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]acetic acid?
The canonical SMILES for 2-[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]acetic acid is COc1ccc(-c2[nH]ncc2CC(=O)O)cc1OC.
What is the InChIKey of 2-[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]acetic acid?
The InChIKey is HOYLXELFDPXFKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O4/c1-18-10-4-3-8(5-11(10)19-2)13-9(6-12(16)17)7-14-15-13/h3-5,7H,6H2,1-2H3,(H,14,15)(H,16,17).
What are the key properties of 2-[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]acetic acid?
2-[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]acetic acid has a molecular weight of 262.26 g/mol, XLogP of 1.72, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]acetic acid is sourced from PubChem (CID 82302588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).