2-[5-(4-methoxy-2,5-dimethylphenyl)-1H-pyrazol-4-yl]acetic acid

C14H16N2O3 — CID 82301593

IUPAC2-[5-(4-methoxy-2,5-dimethylphenyl)-1H-pyrazol-4-yl]acetic acid
SMILESCOc1cc(C)c(-c2[nH]ncc2CC(=O)O)cc1C
InChIInChI=1S/C14H16N2O3/c1-8-5-12(19-3)9(2)4-11(8)14-10(6-13(17)18)7-15-16-14/h4-5,7H,6H2,1-3H3,(H,15,16)(H,17,18)
InChIKeyUWGVAUKLDIQXDJ-UHFFFAOYSA-N
MW260.29 g/mol
LogP2.33
Rot. Bonds4

About 2-[5-(4-methoxy-2,5-dimethylphenyl)-1H-pyrazol-4-yl]acetic acid

2-[5-(4-methoxy-2,5-dimethylphenyl)-1H-pyrazol-4-yl]acetic acid (PubChem CID 82301593) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 2-[5-(4-methoxy-2,5-dimethylphenyl)-1H-pyrazol-4-yl]acetic acid.

Molecular Properties

Compound Name2-[5-(4-methoxy-2,5-dimethylphenyl)-1H-pyrazol-4-yl]acetic acid
PubChem CID82301593
Molecular FormulaC14H16N2O3
Molecular Weight260.29 g/mol
Exact Mass260.12
IUPAC Name2-[5-(4-methoxy-2,5-dimethylphenyl)-1H-pyrazol-4-yl]acetic acid
SMILESCOc1cc(C)c(-c2[nH]ncc2CC(=O)O)cc1C
InChIInChI=1S/C14H16N2O3/c1-8-5-12(19-3)9(2)4-11(8)14-10(6-13(17)18)7-15-16-14/h4-5,7H,6H2,1-3H3,(H,15,16)(H,17,18)
InChIKeyUWGVAUKLDIQXDJ-UHFFFAOYSA-N
XLogP2.33
TPSA75.21 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.29
LogP ≤ 52.33
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-[5-(4-methoxy-2,5-dimethylphenyl)-1H-pyrazol-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[5-(4-methoxy-2,5-dimethylphenyl)-1H-pyrazol-4-yl]acetic acid?
The IUPAC name of 2-[5-(4-methoxy-2,5-dimethylphenyl)-1H-pyrazol-4-yl]acetic acid (CID 82301593) is 2-[5-(4-methoxy-2,5-dimethylphenyl)-1H-pyrazol-4-yl]acetic acid.
What is the SMILES notation for 2-[5-(4-methoxy-2,5-dimethylphenyl)-1H-pyrazol-4-yl]acetic acid?
The canonical SMILES for 2-[5-(4-methoxy-2,5-dimethylphenyl)-1H-pyrazol-4-yl]acetic acid is COc1cc(C)c(-c2[nH]ncc2CC(=O)O)cc1C.
What is the InChIKey of 2-[5-(4-methoxy-2,5-dimethylphenyl)-1H-pyrazol-4-yl]acetic acid?
The InChIKey is UWGVAUKLDIQXDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O3/c1-8-5-12(19-3)9(2)4-11(8)14-10(6-13(17)18)7-15-16-14/h4-5,7H,6H2,1-3H3,(H,15,16)(H,17,18).
What are the key properties of 2-[5-(4-methoxy-2,5-dimethylphenyl)-1H-pyrazol-4-yl]acetic acid?
2-[5-(4-methoxy-2,5-dimethylphenyl)-1H-pyrazol-4-yl]acetic acid has a molecular weight of 260.29 g/mol, XLogP of 2.33, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(4-methoxy-2,5-dimethylphenyl)-1H-pyrazol-4-yl]acetic acid is sourced from PubChem (CID 82301593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).