C14H17N3O4 — CID 170879716
2-amino-3-[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]propanoic acid (PubChem CID 170879716) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is 2-amino-3-[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]propanoic acid.
| Compound Name | 2-amino-3-[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 170879716 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 2-amino-3-[5-(3,4-dimethoxyphenyl)-1H-pyrazol-4-yl]propanoic acid |
| SMILES | COc1ccc(-c2[nH]ncc2CC(N)C(=O)O)cc1OC |
| InChI | InChI=1S/C14H17N3O4/c1-20-11-4-3-8(6-12(11)21-2)13-9(7-16-17-13)5-10(15)14(18)19/h3-4,6-7,10H,5,15H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | IHOPITVIWZFPRW-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |