C30H33N3O2 — CID 71755117
N-[4-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylcarbamoyl]phenyl]-4-phenylbenzamide (PubChem CID 71755117) has the molecular formula C30H33N3O2 and a molecular weight of 467.61 g/mol. Its IUPAC name is N-[4-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylcarbamoyl]phenyl]-4-phenylbenzamide.
| Compound Name | N-[4-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylcarbamoyl]phenyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 71755117 |
| Molecular Formula | C30H33N3O2 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | N-[4-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylcarbamoyl]phenyl]-4-phenylbenzamide |
| SMILES | O=C(NC[C@@H]1CCCN2CCCC[C@H]12)c1ccc(NC(=O)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C30H33N3O2/c34-29(31-21-26-9-6-20-33-19-5-4-10-28(26)33)24-15-17-27(18-16-24)32-30(35)25-13-11-23(12-14-25)22-7-2-1-3-8-22/h1-3,7-8,11-18,26,28H,4-6,9-10,19-21H2,(H,31,34)(H,32,35)/t26-,28+/m0/s1 |
| InChIKey | OJKMMBZPIPQDDE-XTEPFMGCSA-N |
| XLogP | 5.60 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |