C21H28N4O — CID 124861903
N-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2,3-dimethylquinoxaline-6-carboxamide (PubChem CID 124861903) has the molecular formula C21H28N4O and a molecular weight of 352.48 g/mol. Its IUPAC name is N-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2,3-dimethylquinoxaline-6-carboxamide.
| Compound Name | N-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2,3-dimethylquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 124861903 |
| Molecular Formula | C21H28N4O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | N-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-2,3-dimethylquinoxaline-6-carboxamide |
| SMILES | Cc1nc2ccc(C(=O)NC[C@H]3CCCN4CCCC[C@H]34)cc2nc1C |
| InChI | InChI=1S/C21H28N4O/c1-14-15(2)24-19-12-16(8-9-18(19)23-14)21(26)22-13-17-6-5-11-25-10-4-3-7-20(17)25/h8-9,12,17,20H,3-7,10-11,13H2,1-2H3,(H,22,26)/t17-,20-/m1/s1 |
| InChIKey | KFHAFRLKRMLNCZ-YLJYHZDGSA-N |
| XLogP | 3.24 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |