C22H31N3O2 — CID 71753850
N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-1-(2-methoxyethyl)indole-5-carboxamide (PubChem CID 71753850) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-1-(2-methoxyethyl)indole-5-carboxamide.
| Compound Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-1-(2-methoxyethyl)indole-5-carboxamide |
|---|---|
| PubChem CID | 71753850 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-1-(2-methoxyethyl)indole-5-carboxamide |
| SMILES | COCCn1ccc2cc(C(=O)NC[C@@H]3CCCN4CCCC[C@H]34)ccc21 |
| InChI | InChI=1S/C22H31N3O2/c1-27-14-13-25-12-9-17-15-18(7-8-21(17)25)22(26)23-16-19-5-4-11-24-10-3-2-6-20(19)24/h7-9,12,15,19-20H,2-6,10-11,13-14,16H2,1H3,(H,23,26)/t19-,20+/m0/s1 |
| InChIKey | VZEZFKFHWPDUJL-VQTJNVASSA-N |
| XLogP | 3.28 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |