C23H33N3O3 — CID 110207074
N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-4,6-dimethoxy-N,1-dimethylindole-2-carboxamide (PubChem CID 110207074) has the molecular formula C23H33N3O3 and a molecular weight of 399.54 g/mol. Its IUPAC name is N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-4,6-dimethoxy-N,1-dimethylindole-2-carboxamide.
| Compound Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-4,6-dimethoxy-N,1-dimethylindole-2-carboxamide |
|---|---|
| PubChem CID | 110207074 |
| Molecular Formula | C23H33N3O3 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-4,6-dimethoxy-N,1-dimethylindole-2-carboxamide |
| SMILES | COc1cc(OC)c2cc(C(=O)N(C)C[C@@H]3CCCN4CCCC[C@H]34)n(C)c2c1 |
| InChI | InChI=1S/C23H33N3O3/c1-24(15-16-8-7-11-26-10-6-5-9-19(16)26)23(27)21-14-18-20(25(21)2)12-17(28-3)13-22(18)29-4/h12-14,16,19H,5-11,15H2,1-4H3/t16-,19+/m0/s1 |
| InChIKey | KEBZZMQUFAJGPU-QFBILLFUSA-N |
| XLogP | 3.53 |
| TPSA | 46.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |