C20H26ClN3O — CID 125338467
N-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-4-chloro-1-methylindole-2-carboxamide (PubChem CID 125338467) has the molecular formula C20H26ClN3O and a molecular weight of 359.90 g/mol. Its IUPAC name is N-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-4-chloro-1-methylindole-2-carboxamide.
| Compound Name | N-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-4-chloro-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 125338467 |
| Molecular Formula | C20H26ClN3O |
| Molecular Weight | 359.90 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | N-[[(1R,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-4-chloro-1-methylindole-2-carboxamide |
| SMILES | Cn1c(C(=O)NC[C@H]2CCCN3CCCC[C@H]23)cc2c(Cl)cccc21 |
| InChI | InChI=1S/C20H26ClN3O/c1-23-18-9-4-7-16(21)15(18)12-19(23)20(25)22-13-14-6-5-11-24-10-3-2-8-17(14)24/h4,7,9,12,14,17H,2-3,5-6,8,10-11,13H2,1H3,(H,22,25)/t14-,17-/m1/s1 |
| InChIKey | VYEVFIWPVHADNM-RHSMWYFYSA-N |
| XLogP | 3.83 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.90 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |