C19H28ClN3O — CID 46983350
N-[2-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylamino]ethyl]-2-chlorobenzamide (PubChem CID 46983350) has the molecular formula C19H28ClN3O and a molecular weight of 349.91 g/mol. Its IUPAC name is N-[2-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylamino]ethyl]-2-chlorobenzamide.
| Compound Name | N-[2-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylamino]ethyl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 46983350 |
| Molecular Formula | C19H28ClN3O |
| Molecular Weight | 349.91 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | N-[2-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylamino]ethyl]-2-chlorobenzamide |
| SMILES | O=C(NCCNC[C@@H]1CCCN2CCCC[C@H]12)c1ccccc1Cl |
| InChI | InChI=1S/C19H28ClN3O/c20-17-8-2-1-7-16(17)19(24)22-11-10-21-14-15-6-5-13-23-12-4-3-9-18(15)23/h1-2,7-8,15,18,21H,3-6,9-14H2,(H,22,24)/t15-,18+/m0/s1 |
| InChIKey | PUNOTNQZMGOGDZ-MAUKXSAKSA-N |
| XLogP | 2.92 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.91 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|