C22H32ClN3O3S — CID 56686011
N-[[(1S)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-1-(4-chlorophenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 56686011) has the molecular formula C22H32ClN3O3S and a molecular weight of 454.04 g/mol. Its IUPAC name is N-[[(1S)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-1-(4-chlorophenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[[(1S)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-1-(4-chlorophenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 56686011 |
| Molecular Formula | C22H32ClN3O3S |
| Molecular Weight | 454.04 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | N-[[(1S)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-1-(4-chlorophenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | O=C(NC[C@@H]1CCCN2CCCCC12)C1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C22H32ClN3O3S/c23-19-6-8-20(9-7-19)30(28,29)26-14-10-17(11-15-26)22(27)24-16-18-4-3-13-25-12-2-1-5-21(18)25/h6-9,17-18,21H,1-5,10-16H2,(H,24,27)/t18-,21?/m0/s1 |
| InChIKey | TWTMAAYOQGHXKM-YMXDCFFPSA-N |
| XLogP | 3.12 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.04 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |