C21H27BrN4O — CID 123132625
N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-3-(4-bromophenyl)-1-methylpyrazole-5-carboxamide (PubChem CID 123132625) has the molecular formula C21H27BrN4O and a molecular weight of 431.38 g/mol. Its IUPAC name is N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-3-(4-bromophenyl)-1-methylpyrazole-5-carboxamide.
| Compound Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-3-(4-bromophenyl)-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 123132625 |
| Molecular Formula | C21H27BrN4O |
| Molecular Weight | 431.38 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-3-(4-bromophenyl)-1-methylpyrazole-5-carboxamide |
| SMILES | Cn1nc(-c2ccc(Br)cc2)cc1C(=O)NCC1CCCN2CCCCC12 |
| InChI | InChI=1S/C21H27BrN4O/c1-25-20(13-18(24-25)15-7-9-17(22)10-8-15)21(27)23-14-16-5-4-12-26-11-3-2-6-19(16)26/h7-10,13,16,19H,2-6,11-12,14H2,1H3,(H,23,27) |
| InChIKey | BWVRGYZEWUOEER-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |