C20H22N4O4 — CID 124862824
3-[(4R)-2,5-dioxo-1-(2-phenylethyl)imidazolidin-4-yl]-N-(6-methoxy-3-pyridinyl)propanamide (PubChem CID 124862824) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is 3-[(4R)-2,5-dioxo-1-(2-phenylethyl)imidazolidin-4-yl]-N-(6-methoxy-3-pyridinyl)propanamide.
| Compound Name | 3-[(4R)-2,5-dioxo-1-(2-phenylethyl)imidazolidin-4-yl]-N-(6-methoxy-3-pyridinyl)propanamide |
|---|---|
| PubChem CID | 124862824 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 3-[(4R)-2,5-dioxo-1-(2-phenylethyl)imidazolidin-4-yl]-N-(6-methoxy-3-pyridinyl)propanamide |
| SMILES | COc1ccc(NC(=O)CC[C@H]2NC(=O)N(CCc3ccccc3)C2=O)cn1 |
| InChI | InChI=1S/C20H22N4O4/c1-28-18-10-7-15(13-21-18)22-17(25)9-8-16-19(26)24(20(27)23-16)12-11-14-5-3-2-4-6-14/h2-7,10,13,16H,8-9,11-12H2,1H3,(H,22,25)(H,23,27)/t16-/m1/s1 |
| InChIKey | OUYXCPKAXQWWQN-MRXNPFEDSA-N |
| XLogP | 1.97 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|