C24H24N4O5 — CID 75357077
3-[1-[(4-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(7-methoxyquinolin-3-yl)propanamide (PubChem CID 75357077) has the molecular formula C24H24N4O5 and a molecular weight of 448.48 g/mol. Its IUPAC name is 3-[1-[(4-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(7-methoxyquinolin-3-yl)propanamide.
| Compound Name | 3-[1-[(4-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(7-methoxyquinolin-3-yl)propanamide |
|---|---|
| PubChem CID | 75357077 |
| Molecular Formula | C24H24N4O5 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 3-[1-[(4-methoxyphenyl)methyl]-2,5-dioxoimidazolidin-4-yl]-N-(7-methoxyquinolin-3-yl)propanamide |
| SMILES | COc1ccc(CN2C(=O)NC(CCC(=O)Nc3cnc4cc(OC)ccc4c3)C2=O)cc1 |
| InChI | InChI=1S/C24H24N4O5/c1-32-18-6-3-15(4-7-18)14-28-23(30)20(27-24(28)31)9-10-22(29)26-17-11-16-5-8-19(33-2)12-21(16)25-13-17/h3-8,11-13,20H,9-10,14H2,1-2H3,(H,26,29)(H,27,31) |
| InChIKey | LCHLVKNPNPCPQD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|