C30H31NO12 — CID 11039264
[(1R,2S,3S,4S,4aR,11bR)-2,3,4-triacetyloxy-5-[(4-methoxyphenyl)methyl]-6-oxo-1,2,3,4,4a,11b-hexahydro-[1,3]dioxolo[4,5-j]phenanthridin-1-yl] acetate (PubChem CID 11039264) has the molecular formula C30H31NO12 and a molecular weight of 597.57 g/mol. Its IUPAC name is [(1R,2S,3S,4S,4aR,11bR)-2,3,4-triacetyloxy-5-[(4-methoxyphenyl)methyl]-6-oxo-1,2,3,4,4a,11b-hexahydro-[1,3]dioxolo[4,5-j]phenanthridin-1-yl] acetate.
| Compound Name | [(1R,2S,3S,4S,4aR,11bR)-2,3,4-triacetyloxy-5-[(4-methoxyphenyl)methyl]-6-oxo-1,2,3,4,4a,11b-hexahydro-[1,3]dioxolo[4,5-j]phenanthridin-1-yl] acetate |
|---|---|
| PubChem CID | 11039264 |
| Molecular Formula | C30H31NO12 |
| Molecular Weight | 597.57 g/mol |
| Exact Mass | 597.18 |
| IUPAC Name | [(1R,2S,3S,4S,4aR,11bR)-2,3,4-triacetyloxy-5-[(4-methoxyphenyl)methyl]-6-oxo-1,2,3,4,4a,11b-hexahydro-[1,3]dioxolo[4,5-j]phenanthridin-1-yl] acetate |
| SMILES | COc1ccc(CN2C(=O)c3cc4c(cc3[C@H]3[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]32)OCO4)cc1 |
| InChI | InChI=1S/C30H31NO12/c1-14(32)40-26-24-20-10-22-23(39-13-38-22)11-21(20)30(36)31(12-18-6-8-19(37-5)9-7-18)25(24)27(41-15(2)33)29(43-17(4)35)28(26)42-16(3)34/h6-11,24-29H,12-13H2,1-5H3/t24-,25-,26-,27+,28+,29+/m1/s1 |
| InChIKey | TZZVOZOAXBNZLC-VUTJFYCQSA-N |
| XLogP | 2.27 |
| TPSA | 153.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.57 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|