C18H16FNO4 — CID 169003710
methyl 5-fluoro-2-[(4-methoxyphenyl)methyl]-3-oxo-1H-isoindole-1-carboxylate (PubChem CID 169003710) has the molecular formula C18H16FNO4 and a molecular weight of 329.33 g/mol. Its IUPAC name is methyl 5-fluoro-2-[(4-methoxyphenyl)methyl]-3-oxo-1H-isoindole-1-carboxylate.
| Compound Name | methyl 5-fluoro-2-[(4-methoxyphenyl)methyl]-3-oxo-1H-isoindole-1-carboxylate |
|---|---|
| PubChem CID | 169003710 |
| Molecular Formula | C18H16FNO4 |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | methyl 5-fluoro-2-[(4-methoxyphenyl)methyl]-3-oxo-1H-isoindole-1-carboxylate |
| SMILES | COC(=O)C1c2ccc(F)cc2C(=O)N1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C18H16FNO4/c1-23-13-6-3-11(4-7-13)10-20-16(18(22)24-2)14-8-5-12(19)9-15(14)17(20)21/h3-9,16H,10H2,1-2H3 |
| InChIKey | ZQXYYCXQAHLUJJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |