C19H16FNO5 — CID 170313231
5-fluoro-2-[(4-methoxyphenyl)methyl]-3-oxo-1-(2-oxoethyl)isoindole-1-carboxylic acid (PubChem CID 170313231) has the molecular formula C19H16FNO5 and a molecular weight of 357.34 g/mol. Its IUPAC name is 5-fluoro-2-[(4-methoxyphenyl)methyl]-3-oxo-1-(2-oxoethyl)isoindole-1-carboxylic acid.
| Compound Name | 5-fluoro-2-[(4-methoxyphenyl)methyl]-3-oxo-1-(2-oxoethyl)isoindole-1-carboxylic acid |
|---|---|
| PubChem CID | 170313231 |
| Molecular Formula | C19H16FNO5 |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 5-fluoro-2-[(4-methoxyphenyl)methyl]-3-oxo-1-(2-oxoethyl)isoindole-1-carboxylic acid |
| SMILES | COc1ccc(CN2C(=O)c3cc(F)ccc3C2(CC=O)C(=O)O)cc1 |
| InChI | InChI=1S/C19H16FNO5/c1-26-14-5-2-12(3-6-14)11-21-17(23)15-10-13(20)4-7-16(15)19(21,8-9-22)18(24)25/h2-7,9-10H,8,11H2,1H3,(H,24,25) |
| InChIKey | KCBIQXGDGZDEOR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|